C32H41F2N3O7 — CID 167397949
4-[2-cyano-5-[[(1S,2R,3S,4R)-3-[(4,4-difluoro-1-hydroxycyclohexyl)methylcarbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid (PubChem CID 167397949) has the molecular formula C32H41F2N3O7 and a molecular weight of 617.69 g/mol. Its IUPAC name is 4-[2-cyano-5-[[(1S,2R,3S,4R)-3-[(4,4-difluoro-1-hydroxycyclohexyl)methylcarbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-cyano-5-[[(1S,2R,3S,4R)-3-[(4,4-difluoro-1-hydroxycyclohexyl)methylcarbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 167397949 |
| Molecular Formula | C32H41F2N3O7 |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 4-[2-cyano-5-[[(1S,2R,3S,4R)-3-[(4,4-difluoro-1-hydroxycyclohexyl)methylcarbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid |
| SMILES | COc1cc(C#N)c(OC2CCC(C)(C(=O)O)CC2)cc1C(=O)N[C@@H]1[C@H]2CC[C@H](C2)[C@@H]1C(=O)NCC1(O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C32H41F2N3O7/c1-30(29(40)41)7-5-21(6-8-30)44-23-15-22(24(43-2)14-20(23)16-35)27(38)37-26-19-4-3-18(13-19)25(26)28(39)36-17-31(42)9-11-32(33,34)12-10-31/h14-15,18-19,21,25-26,42H,3-13,17H2,1-2H3,(H,36,39)(H,37,38)(H,40,41)/t18-,19+,21?,25+,26-,30?/m1/s1 |
| InChIKey | YHRLQKPEDYEPNK-NBAFCFSPSA-N |
| XLogP | 4.18 |
| TPSA | 157.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |