C29H37N5O2 — CID 16739810
N,N-diethyl-2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]oxy]ethanamine (PubChem CID 16739810) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N,N-diethyl-2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]oxy]ethanamine.
| Compound Name | N,N-diethyl-2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 16739810 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N,N-diethyl-2-[[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]oxy]ethanamine |
| SMILES | CCN(CC)CCOc1ccc2cc1CN(C)C/C=C\CCOc1cccc(c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C29H37N5O2/c1-4-34(5-2)17-19-36-28-13-12-25-20-24(28)22-33(3)16-7-6-8-18-35-26-11-9-10-23(21-26)27-14-15-30-29(31-25)32-27/h6-7,9-15,20-21H,4-5,8,16-19,22H2,1-3H3,(H,30,31,32)/b7-6- |
| InChIKey | PCPQEEKOBNWGAR-SREVYHEPSA-N |
| XLogP | 5.38 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|