C23H23FN4O — CID 16739835
(16E)-23-fluoro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene (PubChem CID 16739835) has the molecular formula C23H23FN4O and a molecular weight of 390.46 g/mol. Its IUPAC name is (16E)-23-fluoro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene.
| Compound Name | (16E)-23-fluoro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
|---|---|
| PubChem CID | 16739835 |
| Molecular Formula | C23H23FN4O |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (16E)-23-fluoro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
| SMILES | CN1C/C=C\CCOc2cc(F)cc(c2)-c2ccnc(n2)Nc2cccc(c2)C1 |
| InChI | InChI=1S/C23H23FN4O/c1-28-10-3-2-4-11-29-21-14-18(13-19(24)15-21)22-8-9-25-23(27-22)26-20-7-5-6-17(12-20)16-28/h2-3,5-9,12-15H,4,10-11,16H2,1H3,(H,25,26,27)/b3-2- |
| InChIKey | MDPQZSCXKLJMQD-IHWYPQMZSA-N |
| XLogP | 4.80 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|