C30H34F3N5O2 — CID 16739902
(16E)-11-(2-pyrrolidin-1-ylethoxy)-14-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 16739902) has the molecular formula C30H34F3N5O2 and a molecular weight of 553.63 g/mol. Its IUPAC name is (16E)-11-(2-pyrrolidin-1-ylethoxy)-14-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16E)-11-(2-pyrrolidin-1-ylethoxy)-14-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 16739902 |
| Molecular Formula | C30H34F3N5O2 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | (16E)-11-(2-pyrrolidin-1-ylethoxy)-14-(2,2,2-trifluoroethyl)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | FC(F)(F)CN1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2ccc(OCCN3CCCC3)c(c2)C1 |
| InChI | InChI=1S/C30H34F3N5O2/c31-30(32,33)22-38-15-2-1-5-17-39-26-8-6-7-23(20-26)27-11-12-34-29(36-27)35-25-9-10-28(24(19-25)21-38)40-18-16-37-13-3-4-14-37/h1-2,6-12,19-20H,3-5,13-18,21-22H2,(H,34,35,36)/b2-1- |
| InChIKey | TXTVDCLCTLZNTD-UPHRSURJSA-N |
| XLogP | 6.06 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|