C27H25ClF5N3O2 — CID 16739908
1-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea (PubChem CID 16739908) has the molecular formula C27H25ClF5N3O2 and a molecular weight of 553.96 g/mol. Its IUPAC name is 1-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea.
| Compound Name | 1-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 16739908 |
| Molecular Formula | C27H25ClF5N3O2 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 1-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea |
| SMILES | O=C(NC1CCCC1)N[C@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C27H25ClF5N3O2/c28-19-10-11-23(34-16-19)26(15-17-6-2-1-3-7-17,36-25(37)35-21-8-4-5-9-21)18-12-20(29)14-22(13-18)38-27(32,33)24(30)31/h1-3,6-7,10-14,16,21,24H,4-5,8-9,15H2,(H2,35,36,37)/t26-/m1/s1 |
| InChIKey | DLEGYAJVPJEXJD-AREMUKBSSA-N |
| XLogP | 6.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|