C25H24F3N5O2 — CID 16739919
2,2,2-trifluoro-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide (PubChem CID 16739919) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide |
|---|---|
| PubChem CID | 16739919 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(16E)-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaen-10-yl]acetamide |
| SMILES | CN1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2cc(cc(NC(=O)C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H24F3N5O2/c1-33-10-3-2-4-11-35-21-7-5-6-18(14-21)22-8-9-29-24(32-22)31-20-13-17(16-33)12-19(15-20)30-23(34)25(26,27)28/h2-3,5-9,12-15H,4,10-11,16H2,1H3,(H,30,34)(H,29,31,32)/b3-2- |
| InChIKey | MYMHNTVTLZQVKZ-IHWYPQMZSA-N |
| XLogP | 5.16 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|