C70H46N6 — CID 167399216
5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-2,9-diphenylbenzimidazolo[1,2-a]benzimidazole (PubChem CID 167399216) has the molecular formula C70H46N6 and a molecular weight of 971.18 g/mol. Its IUPAC name is 5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-2,9-diphenylbenzimidazolo[1,2-a]benzimidazole.
| Compound Name | 5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-2,9-diphenylbenzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 167399216 |
| Molecular Formula | C70H46N6 |
| Molecular Weight | 971.18 g/mol |
| Exact Mass | 970.38 |
| IUPAC Name | 5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-2,9-diphenylbenzimidazolo[1,2-a]benzimidazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccccc5)c(-n5c6ccc(-c7ccccc7)cc6n6c7cc(-c8ccccc8)ccc7nc56)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C70H46N6/c1-7-19-47(20-8-1)51-31-35-55(36-32-51)67-72-68(56-37-33-52(34-38-56)48-21-9-2-10-22-48)74-69(73-67)59-43-60(53-27-15-5-16-28-53)66(61(44-59)54-29-17-6-18-30-54)76-63-42-40-58(50-25-13-4-14-26-50)46-65(63)75-64-45-57(49-23-11-3-12-24-49)39-41-62(64)71-70(75)76/h1-46H |
| InChIKey | JEUOTSRCVMWFFZ-UHFFFAOYSA-N |
| XLogP | 17.62 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.18 |
| LogP ≤ 5 | 17.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |