C28H20ClF6N3O2 — CID 16739941
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea (PubChem CID 16739941) has the molecular formula C28H20ClF6N3O2 and a molecular weight of 579.93 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 16739941 |
| Molecular Formula | C28H20ClF6N3O2 |
| Molecular Weight | 579.93 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C28H20ClF6N3O2/c29-19-9-10-24(36-16-19)27(15-17-5-2-1-3-6-17,38-26(39)37-22-8-4-7-20(30)13-22)18-11-21(31)14-23(12-18)40-28(34,35)25(32)33/h1-14,16,25H,15H2,(H2,37,38,39)/t27-/m0/s1 |
| InChIKey | IBGVWNNOCOBPCT-MHZLTWQESA-N |
| XLogP | 7.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.93 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|