C23H24N4O — CID 16739949
(16E)-19-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaene (PubChem CID 16739949) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is (16E)-19-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaene.
| Compound Name | (16E)-19-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaene |
|---|---|
| PubChem CID | 16739949 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (16E)-19-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8,10,12(26),16,21(25),22-decaene |
| SMILES | CN1C/C=C/COCc2cccc(c2)Nc2nccc(n2)-c2cccc(c2)C1 |
| InChI | InChI=1S/C23H24N4O/c1-27-12-2-3-13-28-17-19-7-5-9-21(15-19)25-23-24-11-10-22(26-23)20-8-4-6-18(14-20)16-27/h2-11,14-15H,12-13,16-17H2,1H3,(H,24,25,26)/b3-2+ |
| InChIKey | VNUICWVLRHUNJF-NSCUHMNNSA-N |
| XLogP | 4.41 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|