C29H22ClF6N3O2 — CID 16739954
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea (PubChem CID 16739954) has the molecular formula C29H22ClF6N3O2 and a molecular weight of 593.96 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 16739954 |
| Molecular Formula | C29H22ClF6N3O2 |
| Molecular Weight | 593.96 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-2-phenylethyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)N[C@@](Cc1ccccc1)(c1cc(F)cc(OCC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C29H22ClF6N3O2/c30-20-9-10-25(37-16-20)28(15-18-5-2-1-3-6-18,39-27(40)38-23-8-4-7-21(31)13-23)19-11-22(32)14-24(12-19)41-17-29(35,36)26(33)34/h1-14,16,26H,15,17H2,(H2,38,39,40)/t28-/m0/s1 |
| InChIKey | ASITYOPYWNNRQL-NDEPHWFRSA-N |
| XLogP | 7.60 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.96 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|