C53H42N4Pt — CID 167399637
2-[diphenyl-[3-(3-propan-2-yl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]methyl]-9-[4-(2-methylphenyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 167399637) has the molecular formula C53H42N4Pt and a molecular weight of 930.03 g/mol. Its IUPAC name is 2-[diphenyl-[3-(3-propan-2-yl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]methyl]-9-[4-(2-methylphenyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[diphenyl-[3-(3-propan-2-yl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]methyl]-9-[4-(2-methylphenyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 167399637 |
| Molecular Formula | C53H42N4Pt |
| Molecular Weight | 930.03 g/mol |
| Exact Mass | 929.31 |
| IUPAC Name | 2-[diphenyl-[3-(3-propan-2-yl-2H-benzimidazol-1-yl)benzene-2-id-1-yl]methyl]-9-[4-(2-methylphenyl)-2-pyridinyl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1ccccc1-c1ccnc(-n2c3[c-]c(C(c4[c-]c(N5CN(C(C)C)c6ccccc65)ccc4)(c4ccccc4)c4ccccc4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C53H42N4.Pt/c1-37(2)55-36-56(50-28-15-14-27-49(50)55)44-23-16-22-42(34-44)53(40-18-6-4-7-19-40,41-20-8-5-9-21-41)43-29-30-47-46-25-12-13-26-48(46)57(51(47)35-43)52-33-39(31-32-54-52)45-24-11-10-17-38(45)3;/h4-33,37H,36H2,1-3H3;/q-2;+2 |
| InChIKey | OVRDYGKWYAZTBA-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.03 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|