C30H34N6O2 — CID 16739965
2-[(16E)-11-(2-pyrrolidin-1-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-14-yl]acetonitrile (PubChem CID 16739965) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 2-[(16E)-11-(2-pyrrolidin-1-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-14-yl]acetonitrile.
| Compound Name | 2-[(16E)-11-(2-pyrrolidin-1-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-14-yl]acetonitrile |
|---|---|
| PubChem CID | 16739965 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 2-[(16E)-11-(2-pyrrolidin-1-ylethoxy)-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-14-yl]acetonitrile |
| SMILES | N#CCN1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2ccc(OCCN3CCCC3)c(c2)C1 |
| InChI | InChI=1S/C30H34N6O2/c31-12-17-36-16-2-1-5-19-37-27-8-6-7-24(22-27)28-11-13-32-30(34-28)33-26-9-10-29(25(21-26)23-36)38-20-18-35-14-3-4-15-35/h1-2,6-11,13,21-22H,3-5,14-20,23H2,(H,32,33,34)/b2-1- |
| InChIKey | AKCFVJMKEAGVQZ-UPHRSURJSA-N |
| XLogP | 5.03 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|