About 3-methyl-1,2-dihydrobenzo[j]aceanthrylene
3-methyl-1,2-dihydrobenzo[j]aceanthrylene (PubChem CID 1674) has the molecular formula C21H16
and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-methyl-1,2-dihydrobenzo[j]aceanthrylene.
Molecular Properties
| Compound Name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylene |
| PubChem CID | 1674 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylene |
| SMILES | Cc1ccc2cc3c(ccc4ccccc43)c3c2c1CC3 |
| InChI | InChI=1S/C21H16/c1-13-6-7-15-12-20-17-5-3-2-4-14(17)8-9-18(20)19-11-10-16(13)21(15)19/h2-9,12H,10-11H2,1H3 |
| InChIKey | PPQNQXQZIWHJRB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,2-dihydrobenzo[j]aceanthrylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2-dihydrobenzo[j]aceanthrylene?
The IUPAC name of 3-methyl-1,2-dihydrobenzo[j]aceanthrylene (CID 1674) is 3-methyl-1,2-dihydrobenzo[j]aceanthrylene.
What is the SMILES notation for 3-methyl-1,2-dihydrobenzo[j]aceanthrylene?
The canonical SMILES for 3-methyl-1,2-dihydrobenzo[j]aceanthrylene is Cc1ccc2cc3c(ccc4ccccc43)c3c2c1CC3.
What is the InChIKey of 3-methyl-1,2-dihydrobenzo[j]aceanthrylene?
The InChIKey is PPQNQXQZIWHJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16/c1-13-6-7-15-12-20-17-5-3-2-4-14(17)8-9-18(20)19-11-10-16(13)21(15)19/h2-9,12H,10-11H2,1H3.
What are the key properties of 3-methyl-1,2-dihydrobenzo[j]aceanthrylene?
3-methyl-1,2-dihydrobenzo[j]aceanthrylene has a molecular weight of 268.36 g/mol, XLogP of 5.55, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2-dihydrobenzo[j]aceanthrylene is sourced from PubChem (CID 1674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).