C31H34N6O4 — CID 167400196
(1S,5R)-N-hydroxy-8-[7-(3-hydroxynaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 167400196) has the molecular formula C31H34N6O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is (1S,5R)-N-hydroxy-8-[7-(3-hydroxynaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | (1S,5R)-N-hydroxy-8-[7-(3-hydroxynaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 167400196 |
| Molecular Formula | C31H34N6O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | (1S,5R)-N-hydroxy-8-[7-(3-hydroxynaphthalen-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | CN1CCC[C@H]1COc1nc(N2[C@@H]3CC[C@H]2CN(C(=O)NO)C3)c2ccc(-c3cc(O)cc4ccccc34)cc2n1 |
| InChI | InChI=1S/C31H34N6O4/c1-35-12-4-6-23(35)18-41-30-32-28-14-20(27-15-24(38)13-19-5-2-3-7-25(19)27)8-11-26(28)29(33-30)37-21-9-10-22(37)17-36(16-21)31(39)34-40/h2-3,5,7-8,11,13-15,21-23,38,40H,4,6,9-10,12,16-18H2,1H3,(H,34,39)/t21-,22+,23-/m0/s1 |
| InChIKey | YJQQCRJFZQCWPT-ZRBLBEILSA-N |
| XLogP | 4.38 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|