C52H37N3S — CID 167401154
N-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-N-phenyldibenzothiophen-1-amine (PubChem CID 167401154) has the molecular formula C52H37N3S and a molecular weight of 735.96 g/mol. Its IUPAC name is N-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-N-phenyldibenzothiophen-1-amine.
| Compound Name | N-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-N-phenyldibenzothiophen-1-amine |
|---|---|
| PubChem CID | 167401154 |
| Molecular Formula | C52H37N3S |
| Molecular Weight | 735.96 g/mol |
| Exact Mass | 735.27 |
| IUPAC Name | N-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-N-phenyldibenzothiophen-1-amine |
| SMILES | C=C/C=C(\C=C)c1cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc(-c2ccccc2)c1N(c1ccccc1)c1cccc2sc3ccccc3c12 |
| InChI | InChI=1S/C52H37N3S/c1-3-20-36(4-2)43-33-40(52-53-45(38-23-11-6-12-24-38)35-46(54-52)39-25-13-7-14-26-39)34-44(37-21-9-5-10-22-37)51(43)55(41-27-15-8-16-28-41)47-30-19-32-49-50(47)42-29-17-18-31-48(42)56-49/h3-35H,1-2H2/b36-20+ |
| InChIKey | JOCCGNCBFOLVHO-ZSNJKBEMSA-N |
| XLogP | 14.74 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.96 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|