About N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide
N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide (PubChem CID 16740155) has the molecular formula C11H9ClN4O3
and a molecular weight of 280.67 g/mol. Its IUPAC name is N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide.
Molecular Properties
| Compound Name | N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide |
| PubChem CID | 16740155 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide |
| SMILES | O=CNc1c(Nc2ccc(Cl)cc2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9ClN4O3/c12-6-1-3-7(4-2-6)14-9-8(13-5-17)10(18)16-11(19)15-9/h1-5H,(H,13,17)(H3,14,15,16,18,19) |
| InChIKey | FCQBZWJMBXZBST-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide?
The IUPAC name of N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide (CID 16740155) is N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide.
What is the SMILES notation for N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide?
The canonical SMILES for N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide is O=CNc1c(Nc2ccc(Cl)cc2)[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide?
The InChIKey is FCQBZWJMBXZBST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN4O3/c12-6-1-3-7(4-2-6)14-9-8(13-5-17)10(18)16-11(19)15-9/h1-5H,(H,13,17)(H3,14,15,16,18,19).
What are the key properties of N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide?
N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide has a molecular weight of 280.67 g/mol, XLogP of 1.03, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(4-chloroanilino)-2,4-dioxo-1H-pyrimidin-5-yl]formamide is sourced from PubChem (CID 16740155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).