C51H36N4S — CID 167401697
12-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylhexa-1,3,5-trien-2-yl]-[1]benzothiolo[2,3-a]carbazole (PubChem CID 167401697) has the molecular formula C51H36N4S and a molecular weight of 736.94 g/mol. Its IUPAC name is 12-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylhexa-1,3,5-trien-2-yl]-[1]benzothiolo[2,3-a]carbazole.
| Compound Name | 12-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylhexa-1,3,5-trien-2-yl]-[1]benzothiolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167401697 |
| Molecular Formula | C51H36N4S |
| Molecular Weight | 736.94 g/mol |
| Exact Mass | 736.27 |
| IUPAC Name | 12-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylhexa-1,3,5-trien-2-yl]-[1]benzothiolo[2,3-a]carbazole |
| SMILES | C=C(/C=C(C(=C\C1=CCCC=C1)\n1c2ccccc2c2ccc3c4ccccc4sc3c21)/c1ccccc1)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C51H36N4S/c1-34(49-52-50(37-22-10-4-11-23-37)54-51(53-49)38-24-12-5-13-25-38)32-43(36-20-8-3-9-21-36)45(33-35-18-6-2-7-19-35)55-44-28-16-14-26-39(44)41-30-31-42-40-27-15-17-29-46(40)56-48(42)47(41)55/h3-6,8-33H,1-2,7H2/b43-32-,45-33- |
| InChIKey | NITFQPJHKIQBAJ-YKYPXGBHSA-N |
| XLogP | 13.60 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.94 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|