C41H29N3O8 — CID 167402658
7-[7-(2-naphthalen-2-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl)-3,4-dihydrodibenzofuran-3-yl]naphthalene-1,2,3,4,5,6,8-heptol (PubChem CID 167402658) has the molecular formula C41H29N3O8 and a molecular weight of 691.70 g/mol. Its IUPAC name is 7-[7-(2-naphthalen-2-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl)-3,4-dihydrodibenzofuran-3-yl]naphthalene-1,2,3,4,5,6,8-heptol.
| Compound Name | 7-[7-(2-naphthalen-2-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl)-3,4-dihydrodibenzofuran-3-yl]naphthalene-1,2,3,4,5,6,8-heptol |
|---|---|
| PubChem CID | 167402658 |
| Molecular Formula | C41H29N3O8 |
| Molecular Weight | 691.70 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | 7-[7-(2-naphthalen-2-yl-6-phenyl-1,4-dihydro-1,3,5-triazin-4-yl)-3,4-dihydrodibenzofuran-3-yl]naphthalene-1,2,3,4,5,6,8-heptol |
| SMILES | Oc1c(O)c(O)c2c(O)c(C3C=Cc4c(oc5cc(C6N=C(c7ccccc7)NC(c7ccc8ccccc8c7)=N6)ccc45)C3)c(O)c(O)c2c1O |
| InChI | InChI=1S/C41H29N3O8/c45-32-29(33(46)34(47)31-30(32)35(48)37(50)38(51)36(31)49)22-12-14-25-26-15-13-24(18-28(26)52-27(25)17-22)41-43-39(20-7-2-1-3-8-20)42-40(44-41)23-11-10-19-6-4-5-9-21(19)16-23/h1-16,18,22,41,45-51H,17H2,(H,42,43,44) |
| InChIKey | ITPVOVPJUWPMOA-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|