C58H39N3O — CID 167403647
N-[(E)-3-dibenzofuran-3-yl-1-phenylprop-2-enylidene]-3,5-diphenyl-4-(3-phenylcarbazol-9-yl)benzenecarboximidamide (PubChem CID 167403647) has the molecular formula C58H39N3O and a molecular weight of 793.97 g/mol. Its IUPAC name is N-[(E)-3-dibenzofuran-3-yl-1-phenylprop-2-enylidene]-3,5-diphenyl-4-(3-phenylcarbazol-9-yl)benzenecarboximidamide.
| Compound Name | N-[(E)-3-dibenzofuran-3-yl-1-phenylprop-2-enylidene]-3,5-diphenyl-4-(3-phenylcarbazol-9-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 167403647 |
| Molecular Formula | C58H39N3O |
| Molecular Weight | 793.97 g/mol |
| Exact Mass | 793.31 |
| IUPAC Name | N-[(E)-3-dibenzofuran-3-yl-1-phenylprop-2-enylidene]-3,5-diphenyl-4-(3-phenylcarbazol-9-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/C=C/c1ccc2c(c1)oc1ccccc12)c1ccccc1)c1cc(-c2ccccc2)c(-n2c3ccccc3c3cc(-c4ccccc4)ccc32)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C58H39N3O/c59-58(60-52(43-23-11-4-12-24-43)33-30-39-29-32-48-47-26-14-16-28-55(47)62-56(48)35-39)45-37-49(41-19-7-2-8-20-41)57(50(38-45)42-21-9-3-10-22-42)61-53-27-15-13-25-46(53)51-36-44(31-34-54(51)61)40-17-5-1-6-18-40/h1-38,59H/b33-30+,59-58-,60-52+ |
| InChIKey | UNRHKSRNAUUIEZ-IWONJHNYSA-N |
| XLogP | 15.21 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.97 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|