C14H16BrN5 — CID 16740447
5-bromo-3-(3-phenylpiperazin-1-yl)pyrazin-2-amine (PubChem CID 16740447) has the molecular formula C14H16BrN5 and a molecular weight of 334.22 g/mol. Its IUPAC name is 5-bromo-3-(3-phenylpiperazin-1-yl)pyrazin-2-amine.
| Compound Name | 5-bromo-3-(3-phenylpiperazin-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 16740447 |
| Molecular Formula | C14H16BrN5 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 5-bromo-3-(3-phenylpiperazin-1-yl)pyrazin-2-amine |
| SMILES | Nc1ncc(Br)nc1N1CCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H16BrN5/c15-12-8-18-13(16)14(19-12)20-7-6-17-11(9-20)10-4-2-1-3-5-10/h1-5,8,11,17H,6-7,9H2,(H2,16,18) |
| InChIKey | IQNZGGJWXBMSKX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |