C15H25F2N3O2 — CID 167404536
prop-2-enyl 4-[(3aS,6aR)-6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl]-3,3,4-trideuterio-2,2-dimethylbutanoate (PubChem CID 167404536) has the molecular formula C15H25F2N3O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is prop-2-enyl 4-[(3aS,6aR)-6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl]-3,3,4-trideuterio-2,2-dimethylbutanoate.
| Compound Name | prop-2-enyl 4-[(3aS,6aR)-6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl]-3,3,4-trideuterio-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 167404536 |
| Molecular Formula | C15H25F2N3O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | prop-2-enyl 4-[(3aS,6aR)-6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl]-3,3,4-trideuterio-2,2-dimethylbutanoate |
| SMILES | [2H]C(N1[C@@H]2[C@H](CN1C)NCC2(F)F)C([2H])([2H])C(C)(C)C(=O)OCC=C |
| InChI | InChI=1S/C15H25F2N3O2/c1-5-8-22-13(21)14(2,3)6-7-20-12-11(9-19(20)4)18-10-15(12,16)17/h5,11-12,18H,1,6-10H2,2-4H3/t11-,12+/m0/s1/i6D2,7D/t7?,11-,12+ |
| InChIKey | VPIZOBSPCYRLBN-BZGLMLBCSA-N |
| XLogP | 1.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|