C46H58O5Si2 — CID 167404813
methoxy-[methoxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silyl]oxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silane (PubChem CID 167404813) has the molecular formula C46H58O5Si2 and a molecular weight of 747.14 g/mol. Its IUPAC name is methoxy-[methoxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silyl]oxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silane.
| Compound Name | methoxy-[methoxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silyl]oxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silane |
|---|---|
| PubChem CID | 167404813 |
| Molecular Formula | C46H58O5Si2 |
| Molecular Weight | 747.14 g/mol |
| Exact Mass | 746.38 |
| IUPAC Name | methoxy-[methoxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silyl]oxy-methyl-[5-[(6-phenyl-7,8-dihydronaphthalen-1-yl)oxy]pentyl]silane |
| SMILES | CO[Si](C)(CCCCCOc1cccc2c1CCC(c1ccccc1)=C2)O[Si](C)(CCCCCOc1cccc2c1CCC(c1ccccc1)=C2)OC |
| InChI | InChI=1S/C46H58O5Si2/c1-47-52(3,33-15-7-13-31-49-45-25-17-23-41-35-39(27-29-43(41)45)37-19-9-5-10-20-37)51-53(4,48-2)34-16-8-14-32-50-46-26-18-24-42-36-40(28-30-44(42)46)38-21-11-6-12-22-38/h5-6,9-12,17-26,35-36H,7-8,13-16,27-34H2,1-4H3 |
| InChIKey | RTMMTAODAWAXGR-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.14 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|