About 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol
5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol (PubChem CID 167404814) has the molecular formula C22H26O
and a molecular weight of 306.45 g/mol. Its IUPAC name is 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol |
| PubChem CID | 167404814 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol |
| SMILES | OCCCCCc1cccc2c1CCCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C22H26O/c23-16-6-2-5-11-19-12-7-14-21-17-20(13-8-15-22(19)21)18-9-3-1-4-10-18/h1,3-4,7,9-10,12,14,17,23H,2,5-6,8,11,13,15-16H2 |
| InChIKey | JPAONRCOVWAZPA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol?
The IUPAC name of 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol (CID 167404814) is 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol.
What is the SMILES notation for 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol?
The canonical SMILES for 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol is OCCCCCc1cccc2c1CCCC(c1ccccc1)=C2.
What is the InChIKey of 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol?
The InChIKey is JPAONRCOVWAZPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O/c23-16-6-2-5-11-19-12-7-14-21-17-20(13-8-15-22(19)21)18-9-3-1-4-10-18/h1,3-4,7,9-10,12,14,17,23H,2,5-6,8,11,13,15-16H2.
What are the key properties of 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol?
5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol has a molecular weight of 306.45 g/mol, XLogP of 5.27, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-1-yl)pentan-1-ol is sourced from PubChem (CID 167404814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).