C32H40O5S — CID 167404865
(6S,8aS)-8-[(2S)-1-cyclohexyl-5-phenylpent-3-yn-2-yl]oxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 167404865) has the molecular formula C32H40O5S and a molecular weight of 536.73 g/mol. Its IUPAC name is (6S,8aS)-8-[(2S)-1-cyclohexyl-5-phenylpent-3-yn-2-yl]oxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6S,8aS)-8-[(2S)-1-cyclohexyl-5-phenylpent-3-yn-2-yl]oxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 167404865 |
| Molecular Formula | C32H40O5S |
| Molecular Weight | 536.73 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (6S,8aS)-8-[(2S)-1-cyclohexyl-5-phenylpent-3-yn-2-yl]oxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C(O[C@H](C#CCc2ccccc2)CC2CCCCC2)C1O |
| InChI | InChI=1S/C32H40O5S/c1-2-38-32-28(33)30(29-27(36-32)22-34-31(37-29)25-18-10-5-11-19-25)35-26(21-24-15-8-4-9-16-24)20-12-17-23-13-6-3-7-14-23/h3,5-7,10-11,13-14,18-19,24,26-33H,2,4,8-9,15-17,21-22H2,1H3/t26-,27?,28?,29+,30?,31?,32+/m1/s1 |
| InChIKey | RUYHIMSOIKWZMZ-KCNAZNJFSA-N |
| XLogP | 5.91 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|