C18H13Cl2N6O2S+ — CID 167405126
N-[5-[(4-chlorophenyl)methoxy]-1,3,4-thiadiazol-2-yl]-3-(2-chloropyridin-1-ium-1-yl)imidazole-4-carboxamide (PubChem CID 167405126) has the molecular formula C18H13Cl2N6O2S+ and a molecular weight of 448.32 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methoxy]-1,3,4-thiadiazol-2-yl]-3-(2-chloropyridin-1-ium-1-yl)imidazole-4-carboxamide.
| Compound Name | N-[5-[(4-chlorophenyl)methoxy]-1,3,4-thiadiazol-2-yl]-3-(2-chloropyridin-1-ium-1-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 167405126 |
| Molecular Formula | C18H13Cl2N6O2S+ |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methoxy]-1,3,4-thiadiazol-2-yl]-3-(2-chloropyridin-1-ium-1-yl)imidazole-4-carboxamide |
| SMILES | O=C(Nc1nnc(OCc2ccc(Cl)cc2)s1)c1cncn1-[n+]1ccccc1Cl |
| InChI | InChI=1S/C18H12Cl2N6O2S/c19-13-6-4-12(5-7-13)10-28-18-24-23-17(29-18)22-16(27)14-9-21-11-26(14)25-8-2-1-3-15(25)20/h1-9,11H,10H2/p+1 |
| InChIKey | ZAUVZVHFDUDIMS-UHFFFAOYSA-O |
| XLogP | 3.47 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|