About 2-piperidin-3-ylazepane
2-piperidin-3-ylazepane (PubChem CID 16740519) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-piperidin-3-ylazepane.
Molecular Properties
| Compound Name | 2-piperidin-3-ylazepane |
| PubChem CID | 16740519 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-piperidin-3-ylazepane |
| SMILES | C1CCNC(C2CCCNC2)CC1 |
| InChI | InChI=1S/C11H22N2/c1-2-6-11(13-8-3-1)10-5-4-7-12-9-10/h10-13H,1-9H2 |
| InChIKey | NILYFVLXUNTUTG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-3-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-3-ylazepane?
The IUPAC name of 2-piperidin-3-ylazepane (CID 16740519) is 2-piperidin-3-ylazepane.
What is the SMILES notation for 2-piperidin-3-ylazepane?
The canonical SMILES for 2-piperidin-3-ylazepane is C1CCNC(C2CCCNC2)CC1.
What is the InChIKey of 2-piperidin-3-ylazepane?
The InChIKey is NILYFVLXUNTUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-2-6-11(13-8-3-1)10-5-4-7-12-9-10/h10-13H,1-9H2.
What are the key properties of 2-piperidin-3-ylazepane?
2-piperidin-3-ylazepane has a molecular weight of 182.31 g/mol, XLogP of 1.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-ylazepane is sourced from PubChem (CID 16740519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).