tert-butyl 2,3-dimethylpiperazine-1-carboxylate

C11H22N2O2 — CID 16740581

IUPACtert-butyl 2,3-dimethylpiperazine-1-carboxylate
SMILESCC1NCCN(C(=O)OC(C)(C)C)C1C
InChIInChI=1S/C11H22N2O2/c1-8-9(2)13(7-6-12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3
InChIKeyRMTXPZPWCLGBFD-UHFFFAOYSA-N
MW214.31 g/mol
LogP1.60
Rot. Bonds

About tert-butyl 2,3-dimethylpiperazine-1-carboxylate

tert-butyl 2,3-dimethylpiperazine-1-carboxylate (PubChem CID 16740581) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is tert-butyl 2,3-dimethylpiperazine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 2,3-dimethylpiperazine-1-carboxylate
PubChem CID16740581
Molecular FormulaC11H22N2O2
Molecular Weight214.31 g/mol
Exact Mass214.17
IUPAC Nametert-butyl 2,3-dimethylpiperazine-1-carboxylate
SMILESCC1NCCN(C(=O)OC(C)(C)C)C1C
InChIInChI=1S/C11H22N2O2/c1-8-9(2)13(7-6-12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3
InChIKeyRMTXPZPWCLGBFD-UHFFFAOYSA-N
XLogP1.60
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2,3-dimethylpiperazine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,3-dimethylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl 2,3-dimethylpiperazine-1-carboxylate (CID 16740581) is tert-butyl 2,3-dimethylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 2,3-dimethylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl 2,3-dimethylpiperazine-1-carboxylate is CC1NCCN(C(=O)OC(C)(C)C)C1C.
What is the InChIKey of tert-butyl 2,3-dimethylpiperazine-1-carboxylate?
The InChIKey is RMTXPZPWCLGBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-8-9(2)13(7-6-12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3.
What are the key properties of tert-butyl 2,3-dimethylpiperazine-1-carboxylate?
tert-butyl 2,3-dimethylpiperazine-1-carboxylate has a molecular weight of 214.31 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3-dimethylpiperazine-1-carboxylate is sourced from PubChem (CID 16740581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).