C32H20O — CID 167406440
1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-dideuteriophenyl)anthracen-9-yl]dibenzofuran (PubChem CID 167406440) has the molecular formula C32H20O and a molecular weight of 437.61 g/mol. Its IUPAC name is 1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-dideuteriophenyl)anthracen-9-yl]dibenzofuran.
| Compound Name | 1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-dideuteriophenyl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 167406440 |
| Molecular Formula | C32H20O |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 1,2,3,4,6,8,9-heptadeuterio-7-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-dideuteriophenyl)anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1cc([2H])cc(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3c([2H])c([2H])c4c(oc5c([2H])c([2H])c([2H])c([2H])c54)c3[2H])c3c([2H])c([2H])c([2H])c([2H])c23)c1 |
| InChI | InChI=1S/C32H20O/c1-2-10-21(11-3-1)31-25-13-4-6-15-27(25)32(28-16-7-5-14-26(28)31)22-18-19-24-23-12-8-9-17-29(23)33-30(24)20-22/h1-20H/i2D,3D,4D,5D,6D,7D,8D,9D,12D,13D,14D,15D,16D,17D,18D,19D,20D |
| InChIKey | POWDQBIAIOOXJM-PFHXKKSOSA-N |
| XLogP | 9.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|