About 3-nitroimidazo[1,2-b]pyridazine
3-nitroimidazo[1,2-b]pyridazine (PubChem CID 16740706) has the molecular formula C6H4N4O2
and a molecular weight of 164.12 g/mol. Its IUPAC name is 3-nitroimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 3-nitroimidazo[1,2-b]pyridazine |
| PubChem CID | 16740706 |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 3-nitroimidazo[1,2-b]pyridazine |
| SMILES | O=[N+]([O-])c1cnc2cccnn12 |
| InChI | InChI=1S/C6H4N4O2/c11-10(12)6-4-7-5-2-1-3-8-9(5)6/h1-4H |
| InChIKey | YWTZZJSJUVSJKG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitroimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroimidazo[1,2-b]pyridazine?
The IUPAC name of 3-nitroimidazo[1,2-b]pyridazine (CID 16740706) is 3-nitroimidazo[1,2-b]pyridazine.
What is the SMILES notation for 3-nitroimidazo[1,2-b]pyridazine?
The canonical SMILES for 3-nitroimidazo[1,2-b]pyridazine is O=[N+]([O-])c1cnc2cccnn12.
What is the InChIKey of 3-nitroimidazo[1,2-b]pyridazine?
The InChIKey is YWTZZJSJUVSJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2/c11-10(12)6-4-7-5-2-1-3-8-9(5)6/h1-4H.
What are the key properties of 3-nitroimidazo[1,2-b]pyridazine?
3-nitroimidazo[1,2-b]pyridazine has a molecular weight of 164.12 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroimidazo[1,2-b]pyridazine is sourced from PubChem (CID 16740706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).