C48H30O — CID 167407345
8-naphthalen-1-yl-1-[2,3,5,6-tetradeuterio-4-(10-phenylanthracen-9-yl)phenyl]dibenzofuran (PubChem CID 167407345) has the molecular formula C48H30O and a molecular weight of 626.79 g/mol. Its IUPAC name is 8-naphthalen-1-yl-1-[2,3,5,6-tetradeuterio-4-(10-phenylanthracen-9-yl)phenyl]dibenzofuran.
| Compound Name | 8-naphthalen-1-yl-1-[2,3,5,6-tetradeuterio-4-(10-phenylanthracen-9-yl)phenyl]dibenzofuran |
|---|---|
| PubChem CID | 167407345 |
| Molecular Formula | C48H30O |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 8-naphthalen-1-yl-1-[2,3,5,6-tetradeuterio-4-(10-phenylanthracen-9-yl)phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c(-c2cccc3oc4ccc(-c5cccc6ccccc56)cc4c23)c([2H])c([2H])c1-c1c2ccccc2c(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C48H30O/c1-2-13-33(14-3-1)46-39-17-6-8-19-41(39)47(42-20-9-7-18-40(42)46)34-26-24-32(25-27-34)38-22-11-23-45-48(38)43-30-35(28-29-44(43)49-45)37-21-10-15-31-12-4-5-16-36(31)37/h1-30H/i24D,25D,26D,27D |
| InChIKey | XVCNHXFEUZRUFN-ZTHNUDSJSA-N |
| XLogP | 13.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|