About 4-piperazin-2-ylphenol
4-piperazin-2-ylphenol (PubChem CID 16740778) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-piperazin-2-ylphenol.
Molecular Properties
| Compound Name | 4-piperazin-2-ylphenol |
| PubChem CID | 16740778 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-piperazin-2-ylphenol |
| SMILES | Oc1ccc(C2CNCCN2)cc1 |
| InChI | InChI=1S/C10H14N2O/c13-9-3-1-8(2-4-9)10-7-11-5-6-12-10/h1-4,10-13H,5-7H2 |
| InChIKey | SASIFHOHGBPKMK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperazin-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-2-ylphenol?
The IUPAC name of 4-piperazin-2-ylphenol (CID 16740778) is 4-piperazin-2-ylphenol.
What is the SMILES notation for 4-piperazin-2-ylphenol?
The canonical SMILES for 4-piperazin-2-ylphenol is Oc1ccc(C2CNCCN2)cc1.
What is the InChIKey of 4-piperazin-2-ylphenol?
The InChIKey is SASIFHOHGBPKMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c13-9-3-1-8(2-4-9)10-7-11-5-6-12-10/h1-4,10-13H,5-7H2.
What are the key properties of 4-piperazin-2-ylphenol?
4-piperazin-2-ylphenol has a molecular weight of 178.24 g/mol, XLogP of 0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-2-ylphenol is sourced from PubChem (CID 16740778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).