C12H16N4O5 — CID 167408540
(2R,3R,4R,5S)-2-(hydroxymethyl)-5-[(4-isocyano-6-methoxypyrimidin-2-yl)amino]oxane-3,4-diol (PubChem CID 167408540) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-5-[(4-isocyano-6-methoxypyrimidin-2-yl)amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-5-[(4-isocyano-6-methoxypyrimidin-2-yl)amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167408540 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-5-[(4-isocyano-6-methoxypyrimidin-2-yl)amino]oxane-3,4-diol |
| SMILES | [C-]#[N+]c1cc(OC)nc(N[C@H]2CO[C@H](CO)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C12H16N4O5/c1-13-8-3-9(20-2)16-12(15-8)14-6-5-21-7(4-17)11(19)10(6)18/h3,6-7,10-11,17-19H,4-5H2,2H3,(H,14,15,16)/t6-,7+,10+,11-/m0/s1 |
| InChIKey | AXHSQQQQGCKALS-HJGGDWJDSA-N |
| XLogP | -1.07 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|