C15H23F3N4O5 — CID 167408629
(2R,3R,4R,5S)-2-[2-(2-aminoethoxy)ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 167408629) has the molecular formula C15H23F3N4O5 and a molecular weight of 396.37 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[2-(2-aminoethoxy)ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[2-(2-aminoethoxy)ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167408629 |
| Molecular Formula | C15H23F3N4O5 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (2R,3R,4R,5S)-2-[2-(2-aminoethoxy)ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | NCCOCCOC[C@H]1OC[C@H](Nc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23F3N4O5/c16-15(17,18)11-1-3-20-14(22-11)21-9-7-27-10(13(24)12(9)23)8-26-6-5-25-4-2-19/h1,3,9-10,12-13,23-24H,2,4-8,19H2,(H,20,21,22)/t9-,10+,12+,13-/m0/s1 |
| InChIKey | BNIQCOTYNOUWDI-YGNMPJRFSA-N |
| XLogP | -0.61 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|