C12H15ClF3N3O5 — CID 167408637
(2R,3R,4R,5R,6S)-5-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (PubChem CID 167408637) has the molecular formula C12H15ClF3N3O5 and a molecular weight of 373.72 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 167408637 |
| Molecular Formula | C12H15ClF3N3O5 |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[[5-chloro-4-(trifluoromethyl)pyrimidin-2-yl]amino]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1ncc(Cl)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H15ClF3N3O5/c1-23-10-6(8(22)7(21)5(3-20)24-10)18-11-17-2-4(13)9(19-11)12(14,15)16/h2,5-8,10,20-22H,3H2,1H3,(H,17,18,19)/t5-,6-,7+,8-,10+/m1/s1 |
| InChIKey | GDFBGPKOIUSQGF-GBMPTNJUSA-N |
| XLogP | 0.01 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |