C16H25F3N4O5 — CID 167408672
(2R,3R,4R,5S)-2-[2-[2-(methylamino)ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 167408672) has the molecular formula C16H25F3N4O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[2-[2-(methylamino)ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[2-[2-(methylamino)ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167408672 |
| Molecular Formula | C16H25F3N4O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2R,3R,4R,5S)-2-[2-[2-(methylamino)ethoxy]ethoxymethyl]-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | CNCCOCCOC[C@H]1OC[C@H](Nc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25F3N4O5/c1-20-4-5-26-6-7-27-9-11-14(25)13(24)10(8-28-11)22-15-21-3-2-12(23-15)16(17,18)19/h2-3,10-11,13-14,20,24-25H,4-9H2,1H3,(H,21,22,23)/t10-,11+,13+,14-/m0/s1 |
| InChIKey | WTWIEHVXOFAQKY-UNJBNNCHSA-N |
| XLogP | -0.35 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|