C9H13N3O5S — CID 167408719
(1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-(1,2,4-thiadiazol-5-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167408719) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-(1,2,4-thiadiazol-5-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-(1,2,4-thiadiazol-5-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167408719 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-(1,2,4-thiadiazol-5-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | OC[C@@]12CO[C@@H](O1)[C@H](Nc1ncns1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H13N3O5S/c13-1-9-2-16-7(17-9)4(5(14)6(9)15)12-8-10-3-11-18-8/h3-7,13-15H,1-2H2,(H,10,11,12)/t4-,5-,6-,7+,9+/m1/s1 |
| InChIKey | GSDJTVNWAHRAIS-LVAAGULDSA-N |
| XLogP | -1.84 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |