C9H13N3O4S — CID 167408789
(1S,2R,3R,4S,5S)-1-methyl-4-(1,2,5-thiadiazol-3-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167408789) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is (1S,2R,3R,4S,5S)-1-methyl-4-(1,2,5-thiadiazol-3-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4S,5S)-1-methyl-4-(1,2,5-thiadiazol-3-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167408789 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (1S,2R,3R,4S,5S)-1-methyl-4-(1,2,5-thiadiazol-3-ylamino)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | C[C@@]12CO[C@@H](O1)[C@@H](Nc1cnsn1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C9H13N3O4S/c1-9-3-15-8(16-9)5(6(13)7(9)14)11-4-2-10-17-12-4/h2,5-8,13-14H,3H2,1H3,(H,11,12)/t5-,6+,7+,8-,9-/m0/s1 |
| InChIKey | MSIFOEPQHHWLPP-ABRLLLAPSA-N |
| XLogP | -0.81 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |