About CID 167410000
CID 167410000 (PubChem CID 167410000) has the molecular formula C44H42O12S2
and a molecular weight of 826.94 g/mol.
Molecular Properties
| Compound Name | CID 167410000 |
| PubChem CID | 167410000 |
| Molecular Formula | C44H42O12S2 |
| Molecular Weight | 826.94 g/mol |
| Exact Mass | 826.21 |
| IUPAC Name | — |
| SMILES | OCCOc1ccc2c(c1OCCO)Sc1ccccc1C21OCc2cc3c(cc2CO1)COC1(OC3)c2ccccc2Sc2c1ccc(OCCO)c2OCCO |
| InChI | InChI=1S/C44H42O12S2/c45-13-17-49-35-11-9-33-41(39(35)51-19-15-47)57-37-7-3-1-5-31(37)43(33)53-23-27-21-29-25-55-44(56-26-30(29)22-28(27)24-54-43)32-6-2-4-8-38(32)58-42-34(44)10-12-36(50-18-14-46)40(42)52-20-16-48/h1-12,21-22,45-48H,13-20,23-26H2 |
| InChIKey | GJFFHLCLDFHBIS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 826.94 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
Analyze CID 167410000 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167410000?
The IUPAC name of CID 167410000 (CID 167410000) is not available.
What is the SMILES notation for CID 167410000?
The canonical SMILES for CID 167410000 is OCCOc1ccc2c(c1OCCO)Sc1ccccc1C21OCc2cc3c(cc2CO1)COC1(OC3)c2ccccc2Sc2c1ccc(OCCO)c2OCCO.
What is the InChIKey of CID 167410000?
The InChIKey is GJFFHLCLDFHBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H42O12S2/c45-13-17-49-35-11-9-33-41(39(35)51-19-15-47)57-37-7-3-1-5-31(37)43(33)53-23-27-21-29-25-55-44(56-26-30(29)22-28(27)24-54-43)32-6-2-4-8-38(32)58-42-34(44)10-12-36(50-18-14-46)40(42)52-20-16-48/h1-12,21-22,45-48H,13-20,23-26H2.
What are the key properties of CID 167410000?
CID 167410000 has a molecular weight of 826.94 g/mol, XLogP of 6.00, 12 rotatable bonds, 4 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167410000 is sourced from PubChem (CID 167410000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).