About CID 167413540
CID 167413540 (PubChem CID 167413540) has the molecular formula C28H21F8IrN10-5
and a molecular weight of 841.75 g/mol.
Molecular Properties
| Compound Name | CID 167413540 |
| PubChem CID | 167413540 |
| Molecular Formula | C28H21F8IrN10-5 |
| Molecular Weight | 841.75 g/mol |
| Exact Mass | 842.15 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]c(N3C=NN(C)[CH-]3)cc(C(F)(F)F)c2)C=N1.Cc1c(C(F)(F)F)n[n-]c1-c1nc(-c2[c-]cc(F)cc2F)cn1C.[Ir] |
| InChI | InChI=1S/C15H9F5N4.C13H12F3N6.Ir/c1-7-12(22-23-13(7)15(18,19)20)14-21-11(6-24(14)2)9-4-3-8(16)5-10(9)17;1-19-8-21(6-17-19)11-3-10(13(14,15)16)4-12(5-11)22-7-18-20(2)9-22;/h3,5-6H,1-2H3;3-4,6-9H,1-2H3;/q-2;-3; |
| InChIKey | NPANKXREEQQGAZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 841.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 167413540 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167413540?
The IUPAC name of CID 167413540 (CID 167413540) is not available.
What is the SMILES notation for CID 167413540?
The canonical SMILES for CID 167413540 is CN1[CH-]N(c2[c-]c(N3C=NN(C)[CH-]3)cc(C(F)(F)F)c2)C=N1.Cc1c(C(F)(F)F)n[n-]c1-c1nc(-c2[c-]cc(F)cc2F)cn1C.[Ir].
What is the InChIKey of CID 167413540?
The InChIKey is NPANKXREEQQGAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F5N4.C13H12F3N6.Ir/c1-7-12(22-23-13(7)15(18,19)20)14-21-11(6-24(14)2)9-4-3-8(16)5-10(9)17;1-19-8-21(6-17-19)11-3-10(13(14,15)16)4-12(5-11)22-7-18-20(2)9-22;/h3,5-6H,1-2H3;3-4,6-9H,1-2H3;/q-2;-3;.
What are the key properties of CID 167413540?
CID 167413540 has a molecular weight of 841.75 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167413540 is sourced from PubChem (CID 167413540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).