About CID 167413549
CID 167413549 (PubChem CID 167413549) has the molecular formula C26H21F5IrN11-5
and a molecular weight of 774.74 g/mol.
Molecular Properties
| Compound Name | CID 167413549 |
| PubChem CID | 167413549 |
| Molecular Formula | C26H21F5IrN11-5 |
| Molecular Weight | 774.74 g/mol |
| Exact Mass | 775.16 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]c(N3C=NN(C)[CH-]3)cc(C(F)(F)F)c2)C=N1.Cc1n[n-]c(-c2nc(-c3[c-]cc(F)cc3F)cn2C)n1.[Ir] |
| InChI | InChI=1S/C13H12F3N6.C13H9F2N5.Ir/c1-19-8-21(6-17-19)11-3-10(13(14,15)16)4-12(5-11)22-7-18-20(2)9-22;1-7-16-12(19-18-7)13-17-11(6-20(13)2)9-4-3-8(14)5-10(9)15;/h3-4,6-9H,1-2H3;3,5-6H,1-2H3;/q-3;-2; |
| InChIKey | HTICNZUGKPKJJW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 774.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 167413549 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167413549?
The IUPAC name of CID 167413549 (CID 167413549) is not available.
What is the SMILES notation for CID 167413549?
The canonical SMILES for CID 167413549 is CN1[CH-]N(c2[c-]c(N3C=NN(C)[CH-]3)cc(C(F)(F)F)c2)C=N1.Cc1n[n-]c(-c2nc(-c3[c-]cc(F)cc3F)cn2C)n1.[Ir].
What is the InChIKey of CID 167413549?
The InChIKey is HTICNZUGKPKJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N6.C13H9F2N5.Ir/c1-19-8-21(6-17-19)11-3-10(13(14,15)16)4-12(5-11)22-7-18-20(2)9-22;1-7-16-12(19-18-7)13-17-11(6-20(13)2)9-4-3-8(14)5-10(9)15;/h3-4,6-9H,1-2H3;3,5-6H,1-2H3;/q-3;-2;.
What are the key properties of CID 167413549?
CID 167413549 has a molecular weight of 774.74 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167413549 is sourced from PubChem (CID 167413549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).