C13H23N3O5S — CID 167416229
3-tert-butyl-N-[methoxy(methyl)sulfamoyl]-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxamide (PubChem CID 167416229) has the molecular formula C13H23N3O5S and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-tert-butyl-N-[methoxy(methyl)sulfamoyl]-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxamide.
| Compound Name | 3-tert-butyl-N-[methoxy(methyl)sulfamoyl]-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxamide |
|---|---|
| PubChem CID | 167416229 |
| Molecular Formula | C13H23N3O5S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-tert-butyl-N-[methoxy(methyl)sulfamoyl]-3a,4,5,6-tetrahydrocyclopenta[d][1,2]oxazole-6a-carboxamide |
| SMILES | CON(C)S(=O)(=O)NC(=O)C12CCCC1C(C(C)(C)C)=NO2 |
| InChI | InChI=1S/C13H23N3O5S/c1-12(2,3)10-9-7-6-8-13(9,21-14-10)11(17)15-22(18,19)16(4)20-5/h9H,6-8H2,1-5H3,(H,15,17) |
| InChIKey | LJSYDAIGYWGXNE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|