C19H23ClN2O — CID 167417070
2-[(2-chloro-4-methylphenoxy)methyl]-6-(piperidin-4-ylmethyl)pyridine (PubChem CID 167417070) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-[(2-chloro-4-methylphenoxy)methyl]-6-(piperidin-4-ylmethyl)pyridine.
| Compound Name | 2-[(2-chloro-4-methylphenoxy)methyl]-6-(piperidin-4-ylmethyl)pyridine |
|---|---|
| PubChem CID | 167417070 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[(2-chloro-4-methylphenoxy)methyl]-6-(piperidin-4-ylmethyl)pyridine |
| SMILES | Cc1ccc(OCc2cccc(CC3CCNCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O/c1-14-5-6-19(18(20)11-14)23-13-17-4-2-3-16(22-17)12-15-7-9-21-10-8-15/h2-6,11,15,21H,7-10,12-13H2,1H3 |
| InChIKey | UFSMNTDLJSCQSA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |