C22H20ClN3O2 — CID 167417316
6-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 167417316) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 6-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 167417316 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 6-[5-(3-chloro-4-isocyanophenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | [C-]#[N+]c1ccc(OC2CC3CC(N4Cc5ncccc5C4=O)CC3C2)cc1Cl |
| InChI | InChI=1S/C22H20ClN3O2/c1-24-20-5-4-16(11-19(20)23)28-17-9-13-7-15(8-14(13)10-17)26-12-21-18(22(26)27)3-2-6-25-21/h2-6,11,13-15,17H,7-10,12H2 |
| InChIKey | JBDWHVSYQSJENX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|