C23H24BrN3O2 — CID 167417828
6-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 167417828) has the molecular formula C23H24BrN3O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 6-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-7,8-dihydro-1,6-naphthyridin-5-one.
| Compound Name | 6-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-7,8-dihydro-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 167417828 |
| Molecular Formula | C23H24BrN3O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 6-[3-(3-bromo-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(N3CCc4ncccc4C3=O)C2(C)C)cc1Br |
| InChI | InChI=1S/C23H24BrN3O2/c1-22(2)20(27-12-10-17-15(19(27)28)7-6-11-26-17)23(3,4)21(22)29-14-8-9-18(25-5)16(24)13-14/h6-9,11,13,20-21H,10,12H2,1-4H3 |
| InChIKey | BBPOSGQNONQUMB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 46.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|