About 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one
3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one (PubChem CID 16741826) has the molecular formula C18H11N3O3
and a molecular weight of 317.30 g/mol. Its IUPAC name is 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one.
Molecular Properties
| Compound Name | 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one |
| PubChem CID | 16741826 |
| Molecular Formula | C18H11N3O3 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one |
| SMILES | O=c1c(-c2nc3[nH]c4ccccc4c3[nH]2)coc2cc(O)ccc12 |
| InChI | InChI=1S/C18H11N3O3/c22-9-5-6-11-14(7-9)24-8-12(16(11)23)17-20-15-10-3-1-2-4-13(10)19-18(15)21-17/h1-8,19,22H,(H,20,21) |
| InChIKey | WPBPYSOJEXTEHD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one?
The IUPAC name of 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one (CID 16741826) is 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one.
What is the SMILES notation for 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one?
The canonical SMILES for 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one is O=c1c(-c2nc3[nH]c4ccccc4c3[nH]2)coc2cc(O)ccc12.
What is the InChIKey of 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one?
The InChIKey is WPBPYSOJEXTEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O3/c22-9-5-6-11-14(7-9)24-8-12(16(11)23)17-20-15-10-3-1-2-4-13(10)19-18(15)21-17/h1-8,19,22H,(H,20,21).
What are the key properties of 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one?
3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one has a molecular weight of 317.30 g/mol, XLogP of 3.52, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dihydroimidazo[4,5-b]indol-2-yl)-7-hydroxychromen-4-one is sourced from PubChem (CID 16741826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).