C50H52BN3 — CID 167419149
4-tert-butyl-8-(4-tert-butylphenyl)-15,15,16,16-tetramethyl-N,N-diphenyl-8,14-diaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaen-11-amine (PubChem CID 167419149) has the molecular formula C50H52BN3 and a molecular weight of 705.80 g/mol. Its IUPAC name is 4-tert-butyl-8-(4-tert-butylphenyl)-15,15,16,16-tetramethyl-N,N-diphenyl-8,14-diaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaen-11-amine.
| Compound Name | 4-tert-butyl-8-(4-tert-butylphenyl)-15,15,16,16-tetramethyl-N,N-diphenyl-8,14-diaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaen-11-amine |
|---|---|
| PubChem CID | 167419149 |
| Molecular Formula | C50H52BN3 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.43 |
| IUPAC Name | 4-tert-butyl-8-(4-tert-butylphenyl)-15,15,16,16-tetramethyl-N,N-diphenyl-8,14-diaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9(22),10,12,17,19,21(23)-nonaen-11-amine |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cccc5c4N(c4cc(N(c6ccccc6)c6ccccc6)cc2c43)C(C)(C)C5(C)C)cc1 |
| InChI | InChI=1S/C50H52BN3/c1-47(2,3)33-24-27-37(28-25-33)53-42-29-26-34(48(4,5)6)30-41(42)51-40-23-17-22-39-46(40)54(50(9,10)49(39,7)8)44-32-38(31-43(53)45(44)51)52(35-18-13-11-14-19-35)36-20-15-12-16-21-36/h11-32H,1-10H3 |
| InChIKey | UNJBHUZOMOMHSG-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|