C13H25N2O6P — CID 16741921
methyl (2S)-1-[(1R,2E)-1-diethoxyphosphoryl-2-hydroxyiminopropyl]pyrrolidine-2-carboxylate (PubChem CID 16741921) has the molecular formula C13H25N2O6P and a molecular weight of 336.33 g/mol. Its IUPAC name is methyl (2S)-1-[(1R,2E)-1-diethoxyphosphoryl-2-hydroxyiminopropyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(1R,2E)-1-diethoxyphosphoryl-2-hydroxyiminopropyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 16741921 |
| Molecular Formula | C13H25N2O6P |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl (2S)-1-[(1R,2E)-1-diethoxyphosphoryl-2-hydroxyiminopropyl]pyrrolidine-2-carboxylate |
| SMILES | CCOP(=O)(OCC)[C@H](/C(C)=N/O)N1CCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C13H25N2O6P/c1-5-20-22(18,21-6-2)12(10(3)14-17)15-9-7-8-11(15)13(16)19-4/h11-12,17H,5-9H2,1-4H3/b14-10+/t11-,12+/m0/s1 |
| InChIKey | OBGQCZUYCKUGHV-OOELYCGDSA-N |
| XLogP | 2.07 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|