C18H17N3O — CID 167419906
1-(1H-indol-6-yl)-3-[(1R,2S)-2-phenylcyclopropyl]urea (PubChem CID 167419906) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-3-[(1R,2S)-2-phenylcyclopropyl]urea.
| Compound Name | 1-(1H-indol-6-yl)-3-[(1R,2S)-2-phenylcyclopropyl]urea |
|---|---|
| PubChem CID | 167419906 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-(1H-indol-6-yl)-3-[(1R,2S)-2-phenylcyclopropyl]urea |
| SMILES | O=C(Nc1ccc2cc[nH]c2c1)N[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17N3O/c22-18(20-14-7-6-13-8-9-19-16(13)10-14)21-17-11-15(17)12-4-2-1-3-5-12/h1-10,15,17,19H,11H2,(H2,20,21,22)/t15-,17+/m0/s1 |
| InChIKey | YSQSAOWQINDAKZ-DOTOQJQBSA-N |
| XLogP | 3.85 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |