C34H38N2O6S2Se2 — CID 16742022
4-methyl-N-[(3S,4R,5R,6S)-5-[(4-methylphenyl)sulfonylamino]-3,6-bis(phenylmethoxymethyl)diselenan-4-yl]benzenesulfonamide (PubChem CID 16742022) has the molecular formula C34H38N2O6S2Se2 and a molecular weight of 792.74 g/mol. Its IUPAC name is 4-methyl-N-[(3S,4R,5R,6S)-5-[(4-methylphenyl)sulfonylamino]-3,6-bis(phenylmethoxymethyl)diselenan-4-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3S,4R,5R,6S)-5-[(4-methylphenyl)sulfonylamino]-3,6-bis(phenylmethoxymethyl)diselenan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 16742022 |
| Molecular Formula | C34H38N2O6S2Se2 |
| Molecular Weight | 792.74 g/mol |
| Exact Mass | 794.05 |
| IUPAC Name | 4-methyl-N-[(3S,4R,5R,6S)-5-[(4-methylphenyl)sulfonylamino]-3,6-bis(phenylmethoxymethyl)diselenan-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2[C@@H](NS(=O)(=O)c3ccc(C)cc3)[C@@H](COCc3ccccc3)[Se][Se][C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H38N2O6S2Se2/c1-25-13-17-29(18-14-25)43(37,38)35-33-31(23-41-21-27-9-5-3-6-10-27)45-46-32(24-42-22-28-11-7-4-8-12-28)34(33)36-44(39,40)30-19-15-26(2)16-20-30/h3-20,31-36H,21-24H2,1-2H3/t31-,32-,33+,34+/m1/s1 |
| InChIKey | XCBVBMULGQTLGA-WZJLIZBTSA-N |
| XLogP | 4.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.74 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|