About 2,6-di(propan-2-yl)-1,4-dihydropyrimidine
2,6-di(propan-2-yl)-1,4-dihydropyrimidine (PubChem CID 167420555) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 2,6-di(propan-2-yl)-1,4-dihydropyrimidine |
| PubChem CID | 167420555 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2,6-di(propan-2-yl)-1,4-dihydropyrimidine |
| SMILES | CC(C)C1=CCN=C(C(C)C)N1 |
| InChI | InChI=1S/C10H18N2/c1-7(2)9-5-6-11-10(12-9)8(3)4/h5,7-8H,6H2,1-4H3,(H,11,12) |
| InChIKey | XXTSIYSVXJLVFZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-di(propan-2-yl)-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(propan-2-yl)-1,4-dihydropyrimidine?
The IUPAC name of 2,6-di(propan-2-yl)-1,4-dihydropyrimidine (CID 167420555) is 2,6-di(propan-2-yl)-1,4-dihydropyrimidine.
What is the SMILES notation for 2,6-di(propan-2-yl)-1,4-dihydropyrimidine?
The canonical SMILES for 2,6-di(propan-2-yl)-1,4-dihydropyrimidine is CC(C)C1=CCN=C(C(C)C)N1.
What is the InChIKey of 2,6-di(propan-2-yl)-1,4-dihydropyrimidine?
The InChIKey is XXTSIYSVXJLVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-7(2)9-5-6-11-10(12-9)8(3)4/h5,7-8H,6H2,1-4H3,(H,11,12).
What are the key properties of 2,6-di(propan-2-yl)-1,4-dihydropyrimidine?
2,6-di(propan-2-yl)-1,4-dihydropyrimidine has a molecular weight of 166.27 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(propan-2-yl)-1,4-dihydropyrimidine is sourced from PubChem (CID 167420555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).